C13H20O4 — CID 101087423
6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 101087423) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 101087423 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOC(=O)C1C(C(=O)O)CC=C(C)C1(C)C |
| InChI | InChI=1S/C13H20O4/c1-5-17-12(16)10-9(11(14)15)7-6-8(2)13(10,3)4/h6,9-10H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | SSGWRNIZPMCUCO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|