About 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid
6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 101087423) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 101087423 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CCOC(=O)C1C(C(=O)O)CC=C(C)C1(C)C |
| InChI | InChI=1S/C13H20O4/c1-5-17-12(16)10-9(11(14)15)7-6-8(2)13(10,3)4/h6,9-10H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | SSGWRNIZPMCUCO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid (CID 101087423) is 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid is CCOC(=O)C1C(C(=O)O)CC=C(C)C1(C)C.
What is the InChIKey of 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid?
The InChIKey is SSGWRNIZPMCUCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-5-17-12(16)10-9(11(14)15)7-6-8(2)13(10,3)4/h6,9-10H,5,7H2,1-4H3,(H,14,15).
What are the key properties of 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid?
6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid has a molecular weight of 240.30 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxycarbonyl-4,5,5-trimethylcyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 101087423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).