C11H17NO5 — CID 101129718
diethyl (3S,4S)-6-oxopiperidine-3,4-dicarboxylate (PubChem CID 101129718) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is diethyl (3S,4S)-6-oxopiperidine-3,4-dicarboxylate.
| Compound Name | diethyl (3S,4S)-6-oxopiperidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101129718 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | diethyl (3S,4S)-6-oxopiperidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)NC[C@H]1C(=O)OCC |
| InChI | InChI=1S/C11H17NO5/c1-3-16-10(14)7-5-9(13)12-6-8(7)11(15)17-4-2/h7-8H,3-6H2,1-2H3,(H,12,13)/t7-,8+/m0/s1 |
| InChIKey | UQEOQUSKESWWGY-JGVFFNPUSA-N |
| XLogP | -0.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |