C15H18NO4+ — CID 14979769
dimethyl (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 14979769) has the molecular formula C15H18NO4+ and a molecular weight of 276.31 g/mol. Its IUPAC name is dimethyl (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14979769 |
| Molecular Formula | C15H18NO4+ |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | dimethyl (1R,2S)-4-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC([n+]2ccccc2)=CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C15H18NO4/c1-19-14(17)12-7-6-11(10-13(12)15(18)20-2)16-8-4-3-5-9-16/h3-6,8-9,12-13H,7,10H2,1-2H3/q+1/t12-,13+/m1/s1 |
| InChIKey | MIPXPTWPTMBRAP-OLZOCXBDSA-N |
| XLogP | 1.19 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|