C16H20NO4+ — CID 10571167
dimethyl (1S,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 10571167) has the molecular formula C16H20NO4+ and a molecular weight of 290.34 g/mol. Its IUPAC name is dimethyl (1S,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10571167 |
| Molecular Formula | C16H20NO4+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | dimethyl (1S,2S)-4-methyl-5-pyridin-1-ium-1-ylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC(C)=C([n+]2ccccc2)C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H20NO4/c1-11-9-12(15(18)20-2)13(16(19)21-3)10-14(11)17-7-5-4-6-8-17/h4-8,12-13H,9-10H2,1-3H3/q+1/t12-,13-/m0/s1 |
| InChIKey | QNXQATRCLRXBNM-STQMWFEESA-N |
| XLogP | 1.58 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|