C13H16BrNO2 — CID 10108684
methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate bromide (PubChem CID 10108684) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate bromide.
| Compound Name | methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate bromide |
|---|---|
| PubChem CID | 10108684 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | methyl 4-pyridin-1-ium-1-ylcyclohex-3-ene-1-carboxylate bromide |
| SMILES | COC(=O)C1CC=C([n+]2ccccc2)CC1.[Br-] |
| InChI | InChI=1S/C13H16NO2.BrH/c1-16-13(15)11-5-7-12(8-6-11)14-9-3-2-4-10-14;/h2-4,7,9-11H,5-6,8H2,1H3;1H/q+1;/p-1 |
| InChIKey | GOJRVPRKQGPCFN-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|