C9H11F3O5S — CID 98051604
methyl (1R)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate (PubChem CID 98051604) has the molecular formula C9H11F3O5S and a molecular weight of 288.24 g/mol. Its IUPAC name is methyl (1R)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 98051604 |
| Molecular Formula | C9H11F3O5S |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | methyl (1R)-4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H11F3O5S/c1-16-8(13)6-2-4-7(5-3-6)17-18(14,15)9(10,11)12/h4,6H,2-3,5H2,1H3/t6-/m0/s1 |
| InChIKey | OWGASBOFFHCLOP-LURJTMIESA-N |
| XLogP | 1.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|