C25H39F3O4S — CID 158248742
4-cyclohexylcyclohexan-1-one;(4-cyclohexylcyclohexen-1-yl) trifluoromethanesulfonate (PubChem CID 158248742) has the molecular formula C25H39F3O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is 4-cyclohexylcyclohexan-1-one;(4-cyclohexylcyclohexen-1-yl) trifluoromethanesulfonate.
| Compound Name | 4-cyclohexylcyclohexan-1-one;(4-cyclohexylcyclohexen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158248742 |
| Molecular Formula | C25H39F3O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 4-cyclohexylcyclohexan-1-one;(4-cyclohexylcyclohexen-1-yl) trifluoromethanesulfonate |
| SMILES | O=C1CCC(C2CCCCC2)CC1.O=S(=O)(OC1=CCC(C2CCCCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H19F3O3S.C12H20O/c14-13(15,16)20(17,18)19-12-8-6-11(7-9-12)10-4-2-1-3-5-10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h8,10-11H,1-7,9H2;10-11H,1-9H2 |
| InChIKey | GGLHHSKXXRNICN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|