C35H58BF3O7S — CID 159580066
2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 159580066) has the molecular formula C35H58BF3O7S and a molecular weight of 690.72 g/mol. Its IUPAC name is 2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | 2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159580066 |
| Molecular Formula | C35H58BF3O7S |
| Molecular Weight | 690.72 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | 2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;[4-[4-(methoxymethyl)cyclohexyl]cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | COCC1CCC(C2CC=C(B3OC(C)(C)C(C)(C)O3)CC2)CC1.COCC1CCC(C2CC=C(OS(=O)(=O)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C20H35BO3.C15H23F3O4S/c1-19(2)20(3,4)24-21(23-19)18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-22-5;1-21-10-11-2-4-12(5-3-11)13-6-8-14(9-7-13)22-23(19,20)15(16,17)18/h12,15-17H,6-11,13-14H2,1-5H3;8,11-13H,2-7,9-10H2,1H3 |
| InChIKey | MIXCUOCASISYCG-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|