C13H21BO4 — CID 99775026
(1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 99775026) has the molecular formula C13H21BO4 and a molecular weight of 252.12 g/mol. Its IUPAC name is (1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 99775026 |
| Molecular Formula | C13H21BO4 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (1S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1(C)OB(C2=CC[C@@H](C(=O)O)CC2)OC1(C)C |
| InChI | InChI=1S/C13H21BO4/c1-12(2)13(3,4)18-14(17-12)10-7-5-9(6-8-10)11(15)16/h7,9H,5-6,8H2,1-4H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | TVALPBGGKJPQPW-SECBINFHSA-N |
| XLogP | 2.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|