C18H30BNO3 — CID 166001224
cyclohexyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 166001224) has the molecular formula C18H30BNO3 and a molecular weight of 319.25 g/mol. Its IUPAC name is cyclohexyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 166001224 |
| Molecular Formula | C18H30BNO3 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | cyclohexyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | CC1(C)OB(C2=CCN(C(=O)C3CCCCC3)CC2)OC1(C)C |
| InChI | InChI=1S/C18H30BNO3/c1-17(2)18(3,4)23-19(22-17)15-10-12-20(13-11-15)16(21)14-8-6-5-7-9-14/h10,14H,5-9,11-13H2,1-4H3 |
| InChIKey | RPVPXNPDJFJXLN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|