C18H30BN3O4 — CID 154879117
N-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]pyrrolidine-3-carboxamide (PubChem CID 154879117) has the molecular formula C18H30BN3O4 and a molecular weight of 363.27 g/mol. Its IUPAC name is N-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]pyrrolidine-3-carboxamide.
| Compound Name | N-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154879117 |
| Molecular Formula | C18H30BN3O4 |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]pyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)N2CC=C(B3OC(C)(C)C(C)(C)O3)CC2)C1 |
| InChI | InChI=1S/C18H30BN3O4/c1-17(2)18(3,4)26-19(25-17)14-7-10-21(11-8-14)16(24)22-9-6-13(12-22)15(23)20-5/h7,13H,6,8-12H2,1-5H3,(H,20,23) |
| InChIKey | BRVPKAUAMAKOJC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|