C19H24BF3N2O3 — CID 166001274
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 166001274) has the molecular formula C19H24BF3N2O3 and a molecular weight of 396.22 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 166001274 |
| Molecular Formula | C19H24BF3N2O3 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC1(C)OB(C2=CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)OC1(C)C |
| InChI | InChI=1S/C19H24BF3N2O3/c1-17(2)18(3,4)28-20(27-17)14-9-11-25(12-10-14)16(26)24-15-7-5-13(6-8-15)19(21,22)23/h5-9H,10-12H2,1-4H3,(H,24,26) |
| InChIKey | AWFAIDKAXMGNKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|