C16H23BN2O4 — CID 176830109
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]oxetane-3-carbonitrile (PubChem CID 176830109) has the molecular formula C16H23BN2O4 and a molecular weight of 318.18 g/mol. Its IUPAC name is 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]oxetane-3-carbonitrile.
| Compound Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 176830109 |
| Molecular Formula | C16H23BN2O4 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carbonyl]oxetane-3-carbonitrile |
| SMILES | CC1(C)OB(C2=CCN(C(=O)C3(C#N)COC3)CC2)OC1(C)C |
| InChI | InChI=1S/C16H23BN2O4/c1-14(2)15(3,4)23-17(22-14)12-5-7-19(8-6-12)13(20)16(9-18)10-21-11-16/h5H,6-8,10-11H2,1-4H3 |
| InChIKey | GZFPSLUWHQXMSN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|