C20H34BN3O3 — CID 139021351
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 139021351) has the molecular formula C20H34BN3O3 and a molecular weight of 375.32 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 139021351 |
| Molecular Formula | C20H34BN3O3 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC1(C)OB(C2=CCN(C(=O)NC3CCN4CCCC4C3)CC2)OC1(C)C |
| InChI | InChI=1S/C20H34BN3O3/c1-19(2)20(3,4)27-21(26-19)15-7-11-24(12-8-15)18(25)22-16-9-13-23-10-5-6-17(23)14-16/h7,16-17H,5-6,8-14H2,1-4H3,(H,22,25) |
| InChIKey | PWNGJYMUSWTLNF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|