C21H34N2O — CID 124856853
(3R,5S)-N-[(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 124856853) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is (3R,5S)-N-[(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3R,5S)-N-[(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 124856853 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | (3R,5S)-N-[(7R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)N[C@@H]4CCN5CCC[C@H]5C4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C21H34N2O/c1-19-9-15-10-20(2,12-19)14-21(11-15,13-19)18(24)22-16-5-7-23-6-3-4-17(23)8-16/h15-17H,3-14H2,1-2H3,(H,22,24)/t15?,16-,17+,19-,20+,21?/m1/s1 |
| InChIKey | UDAXJCVJNFABGB-ZDAGSOFHSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |