C17H28N2O — CID 79997798
3,5-dimethyl-N-pyrrolidin-3-yladamantane-1-carboxamide (PubChem CID 79997798) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 3,5-dimethyl-N-pyrrolidin-3-yladamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-pyrrolidin-3-yladamantane-1-carboxamide |
|---|---|
| PubChem CID | 79997798 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3,5-dimethyl-N-pyrrolidin-3-yladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NC1CCNC1)(C3)C2 |
| InChI | InChI=1S/C17H28N2O/c1-15-5-12-6-16(2,9-15)11-17(7-12,10-15)14(20)19-13-3-4-18-8-13/h12-13,18H,3-11H2,1-2H3,(H,19,20) |
| InChIKey | IUTBIIJSFYKTBL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |