C17H25BN2O4 — CID 142556240
(3R)-3-hydroxy-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 142556240) has the molecular formula C17H25BN2O4 and a molecular weight of 332.21 g/mol. Its IUPAC name is (3R)-3-hydroxy-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-hydroxy-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 142556240 |
| Molecular Formula | C17H25BN2O4 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (3R)-3-hydroxy-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CC1(C)OB(c2ccc(NC(=O)N3CC[C@@H](O)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C17H25BN2O4/c1-16(2)17(3,4)24-18(23-16)12-5-7-13(8-6-12)19-15(22)20-10-9-14(21)11-20/h5-8,14,21H,9-11H2,1-4H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | AZSMHQOQEQXIJH-CQSZACIVSA-N |
| XLogP | 1.58 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|