C12H18INO — CID 138702100
cyclohexyl-(4-iodo-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 138702100) has the molecular formula C12H18INO and a molecular weight of 319.19 g/mol. Its IUPAC name is cyclohexyl-(4-iodo-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | cyclohexyl-(4-iodo-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 138702100 |
| Molecular Formula | C12H18INO |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | cyclohexyl-(4-iodo-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CC=C(I)CC1 |
| InChI | InChI=1S/C12H18INO/c13-11-6-8-14(9-7-11)12(15)10-4-2-1-3-5-10/h6,10H,1-5,7-9H2 |
| InChIKey | PHDIKUGTHRZPOJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|