C20H27BO4 — CID 86692346
benzyl (1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate (PubChem CID 86692346) has the molecular formula C20H27BO4 and a molecular weight of 342.24 g/mol. Its IUPAC name is benzyl (1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate.
| Compound Name | benzyl (1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 86692346 |
| Molecular Formula | C20H27BO4 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | benzyl (1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC1(C)OB(C2=CC[C@H](C(=O)OCc3ccccc3)CC2)OC1(C)C |
| InChI | InChI=1S/C20H27BO4/c1-19(2)20(3,4)25-21(24-19)17-12-10-16(11-13-17)18(22)23-14-15-8-6-5-7-9-15/h5-9,12,16H,10-11,13-14H2,1-4H3/t16-/m0/s1 |
| InChIKey | DWLHYIWVJCQMAA-INIZCTEOSA-N |
| XLogP | 4.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|