C25H30BF3NO4- — CID 158297583
benzyl cyclopropanecarboxylate;[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methylazanide (PubChem CID 158297583) has the molecular formula C25H30BF3NO4- and a molecular weight of 476.32 g/mol. Its IUPAC name is benzyl cyclopropanecarboxylate;[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methylazanide.
| Compound Name | benzyl cyclopropanecarboxylate;[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methylazanide |
|---|---|
| PubChem CID | 158297583 |
| Molecular Formula | C25H30BF3NO4- |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | benzyl cyclopropanecarboxylate;[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methylazanide |
| SMILES | CC1(C)OB(c2ccc(C(F)(F)F)cc2C[NH-])OC1(C)C.O=C(OCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C14H18BF3NO2.C11H12O2/c1-12(2)13(3,4)21-15(20-12)11-6-5-10(14(16,17)18)7-9(11)8-19;12-11(10-6-7-10)13-8-9-4-2-1-3-5-9/h5-7,19H,8H2,1-4H3;1-5,10H,6-8H2/q-1; |
| InChIKey | GMCFBPJUKPSVGP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 68.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|