C24H32BF3N2O3 — CID 143845435
1-benzyl-3-ethylurea;4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (PubChem CID 143845435) has the molecular formula C24H32BF3N2O3 and a molecular weight of 464.34 g/mol. Its IUPAC name is 1-benzyl-3-ethylurea;4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 1-benzyl-3-ethylurea;4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143845435 |
| Molecular Formula | C24H32BF3N2O3 |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 1-benzyl-3-ethylurea;4,4,5,5-tetramethyl-2-[2-methyl-4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CCNC(=O)NCc1ccccc1.Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H18BF3O2.C10H14N2O/c1-9-8-10(14(16,17)18)6-7-11(9)15-19-12(2,3)13(4,5)20-15;1-2-11-10(13)12-8-9-6-4-3-5-7-9/h6-8H,1-5H3;3-7H,2,8H2,1H3,(H2,11,12,13) |
| InChIKey | LYGNSVKMGLWPFT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|