C12H20BNO4 — CID 123182386
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine-2-carboxylic acid (PubChem CID 123182386) has the molecular formula C12H20BNO4 and a molecular weight of 253.11 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine-2-carboxylic acid.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 123182386 |
| Molecular Formula | C12H20BNO4 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine-2-carboxylic acid |
| SMILES | CC1(C)OB(C2=CCNC(C(=O)O)C2)OC1(C)C |
| InChI | InChI=1S/C12H20BNO4/c1-11(2)12(3,4)18-13(17-11)8-5-6-14-9(7-8)10(15)16/h5,9,14H,6-7H2,1-4H3,(H,15,16) |
| InChIKey | PPDSJBCBQSALEK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|