C15H27BO2 — CID 142729657
4,4,5,5-tetramethyl-2-[(5S)-4,4,5-trimethylcyclohexen-1-yl]-1,3,2-dioxaborolane (PubChem CID 142729657) has the molecular formula C15H27BO2 and a molecular weight of 250.19 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(5S)-4,4,5-trimethylcyclohexen-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(5S)-4,4,5-trimethylcyclohexen-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142729657 |
| Molecular Formula | C15H27BO2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(5S)-4,4,5-trimethylcyclohexen-1-yl]-1,3,2-dioxaborolane |
| SMILES | C[C@H]1CC(B2OC(C)(C)C(C)(C)O2)=CCC1(C)C |
| InChI | InChI=1S/C15H27BO2/c1-11-10-12(8-9-13(11,2)3)16-17-14(4,5)15(6,7)18-16/h8,11H,9-10H2,1-7H3/t11-/m0/s1 |
| InChIKey | AHCURVZCPRUYNH-NSHDSACASA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|