C17H29BO3 — CID 90456155
2-(1,1-dimethyl-2-oxaspiro[4.5]dec-7-en-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90456155) has the molecular formula C17H29BO3 and a molecular weight of 292.23 g/mol. Its IUPAC name is 2-(1,1-dimethyl-2-oxaspiro[4.5]dec-7-en-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,1-dimethyl-2-oxaspiro[4.5]dec-7-en-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90456155 |
| Molecular Formula | C17H29BO3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-(1,1-dimethyl-2-oxaspiro[4.5]dec-7-en-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OCCC12CC=C(B1OC(C)(C)C(C)(C)O1)CC2 |
| InChI | InChI=1S/C17H29BO3/c1-14(2)15(3,4)21-18(20-14)13-7-9-17(10-8-13)11-12-19-16(17,5)6/h7H,8-12H2,1-6H3 |
| InChIKey | OCGPNABCQQTNCW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|