C13H21BO5 — CID 138108111
4,4,5,5-tetramethyl-2-(1,4,9-trioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane (PubChem CID 138108111) has the molecular formula C13H21BO5 and a molecular weight of 268.12 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1,4,9-trioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1,4,9-trioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 138108111 |
| Molecular Formula | C13H21BO5 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1,4,9-trioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CCC3(CO2)OCCO3)OC1(C)C |
| InChI | InChI=1S/C13H21BO5/c1-11(2)12(3,4)19-14(18-11)10-5-6-13(9-15-10)16-7-8-17-13/h5H,6-9H2,1-4H3 |
| InChIKey | LPSPHCQSTVLDCM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|