C14H25BO3 — CID 142308201
1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol (PubChem CID 142308201) has the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. Its IUPAC name is 1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol.
| Compound Name | 1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 142308201 |
| Molecular Formula | C14H25BO3 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol |
| SMILES | CCC1(O)CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C14H25BO3/c1-6-14(16)9-7-11(8-10-14)15-17-12(2,3)13(4,5)18-15/h7,16H,6,8-10H2,1-5H3 |
| InChIKey | LQUKEHWDUDJNIJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|