C16H27BO3 — CID 140813860
4,4,5,5-tetramethyl-2-(1-oxaspiro[5.5]undec-9-en-9-yl)-1,3,2-dioxaborolane (PubChem CID 140813860) has the molecular formula C16H27BO3 and a molecular weight of 278.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1-oxaspiro[5.5]undec-9-en-9-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1-oxaspiro[5.5]undec-9-en-9-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140813860 |
| Molecular Formula | C16H27BO3 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1-oxaspiro[5.5]undec-9-en-9-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CCC3(CCCCO3)CC2)OC1(C)C |
| InChI | InChI=1S/C16H27BO3/c1-14(2)15(3,4)20-17(19-14)13-7-10-16(11-8-13)9-5-6-12-18-16/h7H,5-6,8-12H2,1-4H3 |
| InChIKey | BTGYGXFNDXGOAK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|