C18H29BO6 — CID 140735206
(11Z)-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,8-dioxacyclotetradec-11-ene-2,7-dione (PubChem CID 140735206) has the molecular formula C18H29BO6 and a molecular weight of 352.24 g/mol. Its IUPAC name is (11Z)-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,8-dioxacyclotetradec-11-ene-2,7-dione.
| Compound Name | (11Z)-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,8-dioxacyclotetradec-11-ene-2,7-dione |
|---|---|
| PubChem CID | 140735206 |
| Molecular Formula | C18H29BO6 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (11Z)-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,8-dioxacyclotetradec-11-ene-2,7-dione |
| SMILES | CC1(C)OB(/C2=C/CCOC(=O)CCCCC(=O)OCC2)OC1(C)C |
| InChI | InChI=1S/C18H29BO6/c1-17(2)18(3,4)25-19(24-17)14-8-7-12-22-15(20)9-5-6-10-16(21)23-13-11-14/h8H,5-7,9-13H2,1-4H3/b14-8+ |
| InChIKey | CVXPNZCKHSALPX-RIYZIHGNSA-N |
| XLogP | 2.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|