C22H30BNO5 — CID 161471985
5-isocyanofuran-2-carboxylic acid;4,4,5,5-tetramethyl-2-spiro[4.5]dec-8-en-8-yl-1,3,2-dioxaborolane (PubChem CID 161471985) has the molecular formula C22H30BNO5 and a molecular weight of 399.30 g/mol. Its IUPAC name is 5-isocyanofuran-2-carboxylic acid;4,4,5,5-tetramethyl-2-spiro[4.5]dec-8-en-8-yl-1,3,2-dioxaborolane.
| Compound Name | 5-isocyanofuran-2-carboxylic acid;4,4,5,5-tetramethyl-2-spiro[4.5]dec-8-en-8-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 161471985 |
| Molecular Formula | C22H30BNO5 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 5-isocyanofuran-2-carboxylic acid;4,4,5,5-tetramethyl-2-spiro[4.5]dec-8-en-8-yl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CCC3(CCCC3)CC2)OC1(C)C.[C-]#[N+]c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C16H27BO2.C6H3NO3/c1-14(2)15(3,4)19-17(18-14)13-7-11-16(12-8-13)9-5-6-10-16;1-7-5-3-2-4(10-5)6(8)9/h7H,5-6,8-12H2,1-4H3;2-3H,(H,8,9) |
| InChIKey | WDFCVPYUTRWMCX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|