C13H18N2O3 — CID 159040756
4,4-dimethylpiperidine;5-isocyanofuran-2-carboxylic acid (PubChem CID 159040756) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4,4-dimethylpiperidine;5-isocyanofuran-2-carboxylic acid.
| Compound Name | 4,4-dimethylpiperidine;5-isocyanofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 159040756 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4,4-dimethylpiperidine;5-isocyanofuran-2-carboxylic acid |
| SMILES | CC1(C)CCNCC1.[C-]#[N+]c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C7H15N.C6H3NO3/c1-7(2)3-5-8-6-4-7;1-7-5-3-2-4(10-5)6(8)9/h8H,3-6H2,1-2H3;2-3H,(H,8,9) |
| InChIKey | JWAHIWWABGBFOG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|