C13H18O4 — CID 114340758
5-(4,4-dimethylcyclohexyl)oxyfuran-2-carboxylic acid (PubChem CID 114340758) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 5-(4,4-dimethylcyclohexyl)oxyfuran-2-carboxylic acid.
| Compound Name | 5-(4,4-dimethylcyclohexyl)oxyfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 114340758 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5-(4,4-dimethylcyclohexyl)oxyfuran-2-carboxylic acid |
| SMILES | CC1(C)CCC(Oc2ccc(C(=O)O)o2)CC1 |
| InChI | InChI=1S/C13H18O4/c1-13(2)7-5-9(6-8-13)16-11-4-3-10(17-11)12(14)15/h3-4,9H,5-8H2,1-2H3,(H,14,15) |
| InChIKey | JYBYHPLFRFOPQU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |