C16H19NO4 — CID 114340769
2-(4,4-dimethylcyclohexyl)oxy-1,3-benzoxazole-6-carboxylic acid (PubChem CID 114340769) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)oxy-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(4,4-dimethylcyclohexyl)oxy-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 114340769 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)oxy-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CC1(C)CCC(Oc2nc3ccc(C(=O)O)cc3o2)CC1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)7-5-11(6-8-16)20-15-17-12-4-3-10(14(18)19)9-13(12)21-15/h3-4,9,11H,5-8H2,1-2H3,(H,18,19) |
| InChIKey | XDIRLQJHCFHPET-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |