C16H21NO4 — CID 116690143
2-octan-2-yloxy-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690143) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-octan-2-yloxy-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-octan-2-yloxy-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690143 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-octan-2-yloxy-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CCCCCCC(C)Oc1nc2ccc(C(=O)O)cc2o1 |
| InChI | InChI=1S/C16H21NO4/c1-3-4-5-6-7-11(2)20-16-17-13-9-8-12(15(18)19)10-14(13)21-16/h8-11H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | WDAUXOYUMWIDNO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|