C16H13NO4 — CID 116690133
2-(3-ethylphenoxy)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690133) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(3-ethylphenoxy)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690133 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(3-ethylphenoxy)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CCc1cccc(Oc2nc3ccc(C(=O)O)cc3o2)c1 |
| InChI | InChI=1S/C16H13NO4/c1-2-10-4-3-5-12(8-10)20-16-17-13-7-6-11(15(18)19)9-14(13)21-16/h3-9H,2H2,1H3,(H,18,19) |
| InChIKey | NXNRFJWFCSSCPL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |