3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid

C14H8ClNO4 — CID 54207586

IUPAC3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid
SMILESO=C(O)c1cccc(Oc2nc3cc(Cl)ccc3o2)c1
InChIInChI=1S/C14H8ClNO4/c15-9-4-5-12-11(7-9)16-14(20-12)19-10-3-1-2-8(6-10)13(17)18/h1-7H,(H,17,18)
InChIKeyPTPZTJSFMLUAJB-UHFFFAOYSA-N
MW289.67 g/mol
LogP3.97
Rot. Bonds3

About 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid

3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid (PubChem CID 54207586) has the molecular formula C14H8ClNO4 and a molecular weight of 289.67 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid.

Molecular Properties

Compound Name3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid
PubChem CID54207586
Molecular FormulaC14H8ClNO4
Molecular Weight289.67 g/mol
Exact Mass289.01
IUPAC Name3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid
SMILESO=C(O)c1cccc(Oc2nc3cc(Cl)ccc3o2)c1
InChIInChI=1S/C14H8ClNO4/c15-9-4-5-12-11(7-9)16-14(20-12)19-10-3-1-2-8(6-10)13(17)18/h1-7H,(H,17,18)
InChIKeyPTPZTJSFMLUAJB-UHFFFAOYSA-N
XLogP3.97
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.67
LogP ≤ 53.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid?
The IUPAC name of 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid (CID 54207586) is 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid.
What is the SMILES notation for 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid?
The canonical SMILES for 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid is O=C(O)c1cccc(Oc2nc3cc(Cl)ccc3o2)c1.
What is the InChIKey of 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid?
The InChIKey is PTPZTJSFMLUAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClNO4/c15-9-4-5-12-11(7-9)16-14(20-12)19-10-3-1-2-8(6-10)13(17)18/h1-7H,(H,17,18).
What are the key properties of 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid?
3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid has a molecular weight of 289.67 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid is sourced from PubChem (CID 54207586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).