C14H8ClNO4 — CID 54207586
3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid (PubChem CID 54207586) has the molecular formula C14H8ClNO4 and a molecular weight of 289.67 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid.
| Compound Name | 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid |
|---|---|
| PubChem CID | 54207586 |
| Molecular Formula | C14H8ClNO4 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 3-[(5-chloro-1,3-benzoxazol-2-yl)oxy]benzoic acid |
| SMILES | O=C(O)c1cccc(Oc2nc3cc(Cl)ccc3o2)c1 |
| InChI | InChI=1S/C14H8ClNO4/c15-9-4-5-12-11(7-9)16-14(20-12)19-10-3-1-2-8(6-10)13(17)18/h1-7H,(H,17,18) |
| InChIKey | PTPZTJSFMLUAJB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |