C15H11NO4 — CID 116690017
2-phenylmethoxy-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690017) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-phenylmethoxy-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-phenylmethoxy-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690017 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-phenylmethoxy-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(OCc3ccccc3)oc2c1 |
| InChI | InChI=1S/C15H11NO4/c17-14(18)11-6-7-12-13(8-11)20-15(16-12)19-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,17,18) |
| InChIKey | PFGAYBALBXIMDZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |