C28H27NO5 — CID 70187931
2-[3-oxo-3-[4-(5-phenylpentoxy)phenyl]propyl]-1,3-benzoxazole-6-carboxylic acid (PubChem CID 70187931) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[3-oxo-3-[4-(5-phenylpentoxy)phenyl]propyl]-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-[3-oxo-3-[4-(5-phenylpentoxy)phenyl]propyl]-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 70187931 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[3-oxo-3-[4-(5-phenylpentoxy)phenyl]propyl]-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(CCC(=O)c3ccc(OCCCCCc4ccccc4)cc3)oc2c1 |
| InChI | InChI=1S/C28H27NO5/c30-25(16-17-27-29-24-15-12-22(28(31)32)19-26(24)34-27)21-10-13-23(14-11-21)33-18-6-2-5-9-20-7-3-1-4-8-20/h1,3-4,7-8,10-15,19H,2,5-6,9,16-18H2,(H,31,32) |
| InChIKey | XCBJEFNKTJSHBN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|