C15H17NO3 — CID 106829420
2-(1-methylcyclohexyl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 106829420) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(1-methylcyclohexyl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(1-methylcyclohexyl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 106829420 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(1-methylcyclohexyl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CC1(c2nc3ccc(C(=O)O)cc3o2)CCCCC1 |
| InChI | InChI=1S/C15H17NO3/c1-15(7-3-2-4-8-15)14-16-11-6-5-10(13(17)18)9-12(11)19-14/h5-6,9H,2-4,7-8H2,1H3,(H,17,18) |
| InChIKey | AIVRFASTXBAIQQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |