C13H21BN2O3 — CID 171655934
5-methyl-1-(2-methyloxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 171655934) has the molecular formula C13H21BN2O3 and a molecular weight of 264.13 g/mol. Its IUPAC name is 5-methyl-1-(2-methyloxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 5-methyl-1-(2-methyloxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 171655934 |
| Molecular Formula | C13H21BN2O3 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-methyl-1-(2-methyloxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cnn1C1(C)CO1 |
| InChI | InChI=1S/C13H21BN2O3/c1-9-10(7-15-16(9)13(6)8-17-13)14-18-11(2,3)12(4,5)19-14/h7H,8H2,1-6H3 |
| InChIKey | AYTHYRQWDQXCNA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 48.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|