C15H25BN2O4 — CID 77165537
4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopentane-1,2-diol (PubChem CID 77165537) has the molecular formula C15H25BN2O4 and a molecular weight of 308.19 g/mol. Its IUPAC name is 4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopentane-1,2-diol.
| Compound Name | 4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 77165537 |
| Molecular Formula | C15H25BN2O4 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclopentane-1,2-diol |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cnn1C1CC(O)C(O)C1 |
| InChI | InChI=1S/C15H25BN2O4/c1-9-11(16-21-14(2,3)15(4,5)22-16)8-17-18(9)10-6-12(19)13(20)7-10/h8,10,12-13,19-20H,6-7H2,1-5H3 |
| InChIKey | RGTSFSBRNBKHPM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|