C20H31BN2O2 — CID 140721830
1-(1-adamantyl)-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 140721830) has the molecular formula C20H31BN2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is 1-(1-adamantyl)-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-(1-adamantyl)-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 140721830 |
| Molecular Formula | C20H31BN2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 1-(1-adamantyl)-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cnn1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H31BN2O2/c1-13-17(21-24-18(2,3)19(4,5)25-21)12-22-23(13)20-9-14-6-15(10-20)8-16(7-14)11-20/h12,14-16H,6-11H2,1-5H3 |
| InChIKey | RVVXLERWUNLZJD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|