C10H16BN3O3 — CID 175525444
2-(oxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (PubChem CID 175525444) has the molecular formula C10H16BN3O3 and a molecular weight of 237.07 g/mol. Its IUPAC name is 2-(oxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole.
| Compound Name | 2-(oxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
|---|---|
| PubChem CID | 175525444 |
| Molecular Formula | C10H16BN3O3 |
| Molecular Weight | 237.07 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-(oxiran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| SMILES | CC1(C)OB(c2cnn(C3CO3)n2)OC1(C)C |
| InChI | InChI=1S/C10H16BN3O3/c1-9(2)10(3,4)17-11(16-9)7-5-12-14(13-7)8-6-15-8/h5,8H,6H2,1-4H3 |
| InChIKey | IGJNVISFGJUKPY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.07 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|