C12H22BN3O2 — CID 172644498
2-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (PubChem CID 172644498) has the molecular formula C12H22BN3O2 and a molecular weight of 251.14 g/mol. Its IUPAC name is 2-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole.
| Compound Name | 2-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
|---|---|
| PubChem CID | 172644498 |
| Molecular Formula | C12H22BN3O2 |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 2-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| SMILES | CCC(C)n1ncc(B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C12H22BN3O2/c1-7-9(2)16-14-8-10(15-16)13-17-11(3,4)12(5,6)18-13/h8-9H,7H2,1-6H3 |
| InChIKey | FNROKTUAAJTEFT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|