C15H27BN2O2 — CID 140824969
1-[(2S)-4-methylpentan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 140824969) has the molecular formula C15H27BN2O2 and a molecular weight of 278.20 g/mol. Its IUPAC name is 1-[(2S)-4-methylpentan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[(2S)-4-methylpentan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 140824969 |
| Molecular Formula | C15H27BN2O2 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-[(2S)-4-methylpentan-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC(C)C[C@H](C)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C15H27BN2O2/c1-11(2)8-12(3)18-10-13(9-17-18)16-19-14(4,5)15(6,7)20-16/h9-12H,8H2,1-7H3/t12-/m0/s1 |
| InChIKey | MOTGHCGCHYLZMI-LBPRGKRZSA-N |
| XLogP | 2.79 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|