C15H28BN3O2 — CID 70868332
N-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentan-1-amine (PubChem CID 70868332) has the molecular formula C15H28BN3O2 and a molecular weight of 293.22 g/mol. Its IUPAC name is N-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentan-1-amine.
| Compound Name | N-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 70868332 |
| Molecular Formula | C15H28BN3O2 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | N-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pentan-1-amine |
| SMILES | CCC(CCNC)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C15H28BN3O2/c1-7-13(8-9-17-6)19-11-12(10-18-19)16-20-14(2,3)15(4,5)21-16/h10-11,13,17H,7-9H2,1-6H3 |
| InChIKey | MMCCXBCSSPHGSJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|