C9H18BN2O2P3 — CID 123424092
bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane (PubChem CID 123424092) has the molecular formula C9H18BN2O2P3 and a molecular weight of 289.99 g/mol. Its IUPAC name is bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane.
| Compound Name | bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane |
|---|---|
| PubChem CID | 123424092 |
| Molecular Formula | C9H18BN2O2P3 |
| Molecular Weight | 289.99 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane |
| SMILES | CC1(C)OB(c2cnn(P(P)P)c2)OC1(C)C |
| InChI | InChI=1S/C9H18BN2O2P3/c1-8(2)9(3,4)14-10(13-8)7-5-11-12(6-7)17(15)16/h5-6H,15-16H2,1-4H3 |
| InChIKey | MKDAWJGAFNQOPT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.99 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|