C14H23BN2O2 — CID 67812664
1-[(1-methylcyclopropyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 67812664) has the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. Its IUPAC name is 1-[(1-methylcyclopropyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[(1-methylcyclopropyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 67812664 |
| Molecular Formula | C14H23BN2O2 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-[(1-methylcyclopropyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC1(Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C14H23BN2O2/c1-12(2)13(3,4)19-15(18-12)11-8-16-17(9-11)10-14(5)6-7-14/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | JXTBHVBERSCOAF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|