C15H25BF2N2O2 — CID 142510572
1-(3,3-difluoro-2,2-dimethylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 142510572) has the molecular formula C15H25BF2N2O2 and a molecular weight of 314.19 g/mol. Its IUPAC name is 1-(3,3-difluoro-2,2-dimethylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-(3,3-difluoro-2,2-dimethylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 142510572 |
| Molecular Formula | C15H25BF2N2O2 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-(3,3-difluoro-2,2-dimethylbutyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC(F)(F)C(C)(C)Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C15H25BF2N2O2/c1-12(2,15(7,17)18)10-20-9-11(8-19-20)16-21-13(3,4)14(5,6)22-16/h8-9H,10H2,1-7H3 |
| InChIKey | KLESTRZPDGSZNU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|