C16H28BN3O3 — CID 165152497
2,2-dimethyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]propanamide (PubChem CID 165152497) has the molecular formula C16H28BN3O3 and a molecular weight of 321.23 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 165152497 |
| Molecular Formula | C16H28BN3O3 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2,2-dimethyl-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C16H28BN3O3/c1-14(2,3)13(21)18-8-9-20-11-12(10-19-20)17-22-15(4,5)16(6,7)23-17/h10-11H,8-9H2,1-7H3,(H,18,21) |
| InChIKey | RAFWQVWWWGBFGW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|