C16H28BN3O2 — CID 59320389
1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]piperidine (PubChem CID 59320389) has the molecular formula C16H28BN3O2 and a molecular weight of 305.23 g/mol. Its IUPAC name is 1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]piperidine.
| Compound Name | 1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]piperidine |
|---|---|
| PubChem CID | 59320389 |
| Molecular Formula | C16H28BN3O2 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]piperidine |
| SMILES | CC1(C)OB(c2cnn(CCN3CCCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C16H28BN3O2/c1-15(2)16(3,4)22-17(21-15)14-12-18-20(13-14)11-10-19-8-6-5-7-9-19/h12-13H,5-11H2,1-4H3 |
| InChIKey | CUDGRVPQYNPZOL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|